Fmoc-beta-chloro-L-alanine structure
|
Common Name | Fmoc-beta-chloro-L-alanine | ||
|---|---|---|---|---|
| CAS Number | 212651-52-0 | Molecular Weight | 345.77700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H16ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Fmoc-β-chloro-L-alanine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H16ClNO4 |
|---|---|
| Molecular Weight | 345.77700 |
| Exact Mass | 345.07700 |
| PSA | 75.63000 |
| LogP | 3.60800 |
| InChIKey | NICWPULFDZCIBU-INIZCTEOSA-N |
| SMILES | O=C(NC(CCl)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| HS Code | 2924299090 |
|---|
|
~78%
Fmoc-beta-chlor... CAS#:212651-52-0 |
| Literature: Deboves; Montalbetti; Jackson Journal of the Chemical Society. Perkin Transactions 1, 2001 , # 16 p. 1876 - 1884 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-hydroxy-2-(4-methylphenyl)acetonitrile |
| (2R)-2-(4-methylphenyl)-2-hydroxyacetonitrile |
| (R)-4-methylbenzaldehyde cyanohydrin |
| (R)-2-hydroxy-2-p-tolylacetonitrile |
| (R)-2-hydroxy-2-(4-methylphenyl)acetonitrile |
| (2R)-2-hydroxy-2-(4-methylphenyl)ethanenitrile |
| Fmoc-b-chloro-Ala-OH |
| (2R)-2-(9H-Fluoren-9-ylmethoxycarbonylamino)-3-chloropropionic acid |
| (R)-(+)-4-Methylmandelonitrile |
| Fmoc-beta-chloro-L-alanine |
| Fmoc-b-chloro-Ala-OH |
| N-α-(9-Fluorenylmethoxycarbonyl)-β-chloro-L-alanine |