Dimer,Parylene F structure
|
Common Name | Dimer,Parylene F | ||
|---|---|---|---|---|
| CAS Number | 1785-64-4 | Molecular Weight | 352.22200 | |
| Density | 1.497g/cm3 | Boiling Point | 321ºC | |
| Molecular Formula | C16H8F8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 117ºC | |
| Name | Dimer,Parylene F |
|---|---|
| Synonym | More Synonyms |
| Density | 1.497g/cm3 |
|---|---|
| Boiling Point | 321ºC |
| Molecular Formula | C16H8F8 |
| Molecular Weight | 352.22200 |
| Flash Point | 117ºC |
| Exact Mass | 352.05000 |
| LogP | 4.68320 |
| InChIKey | GUHKMHMGKKRFDT-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c2c(F)c(F)c1CCc1c(F)c(F)c(c(F)c1F)CC2 |
|
~%
Dimer,Parylene F CAS#:1785-64-4 |
| Literature: Filler,R.; Cantrell,G.L.; Wolanin,D. Journal of Fluorine Chemistry, 1986 , vol. 30, p. 399 |
|
~%
Dimer,Parylene F CAS#:1785-64-4 |
| Literature: Filler,R.; Cantrell,G.L.; Wolanin,D. Journal of Fluorine Chemistry, 1986 , vol. 30, p. 399 |
|
~26%
Dimer,Parylene F CAS#:1785-64-4 |
| Literature: Filler,R.; Cantrell,G.L.; Wolanin,D. Journal of Fluorine Chemistry, 1986 , vol. 30, p. 399 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Parylene F |
| 5,6,11,12,13,14,15,16-Octafluorotricyclo[8.2.2.24,7]hexadeca-4,6,10,12,13,15-hexaene |
| 4,5,7,8,12,13,15,16-octafluoro(2.2)paracyclophane |
| octafluoro<2.2>paracyclophane |
| Parylene F Dimer |
| Octafluor-<2.2>paracyclophan |
| 2,2',3,3',5,5',6,6'-Oktafluor-<2.2>paracyclophan |