Benzene,1,1'-[1,2-ethanediylbis(oxy)]bis[4-nitro structure
|
Common Name | Benzene,1,1'-[1,2-ethanediylbis(oxy)]bis[4-nitro | ||
|---|---|---|---|---|
| CAS Number | 14467-69-7 | Molecular Weight | 304.25500 | |
| Density | 1.37g/cm3 | Boiling Point | 501.7ºC at 760mmHg | |
| Molecular Formula | C14H12N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.1ºC | |
| Name | 1-nitro-4-[2-(4-nitrophenoxy)ethoxy]benzene |
|---|
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 501.7ºC at 760mmHg |
| Molecular Formula | C14H12N2O6 |
| Molecular Weight | 304.25500 |
| Flash Point | 226.1ºC |
| Exact Mass | 304.07000 |
| PSA | 110.10000 |
| LogP | 4.00720 |
| Vapour Pressure | 1.06E-09mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | DGNVEKKAEPFSIH-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(OCCOc2ccc([N+](=O)[O-])cc2)cc1 |
| Precursor 10 | |
|---|---|
| DownStream 2 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|