Benzene,1,1',1'',1'''-(1,2-ethenediylidene)tetrakis[4-methoxy structure
|
Common Name | Benzene,1,1',1'',1'''-(1,2-ethenediylidene)tetrakis[4-methoxy | ||
|---|---|---|---|---|
| CAS Number | 10019-24-6 | Molecular Weight | 452.54100 | |
| Density | 1.126g/cm3 | Boiling Point | 574.1ºC at 760 mmHg | |
| Molecular Formula | C30H28O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.1ºC | |
| Name | 1-methoxy-4-[1,2,2-tris(4-methoxyphenyl)ethenyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.126g/cm3 |
|---|---|
| Boiling Point | 574.1ºC at 760 mmHg |
| Molecular Formula | C30H28O4 |
| Molecular Weight | 452.54100 |
| Flash Point | 123.1ºC |
| Exact Mass | 452.19900 |
| PSA | 36.92000 |
| LogP | 6.72840 |
| Vapour Pressure | 1.37E-12mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | LXYBRRVOIQFRRL-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=C(c2ccc(OC)cc2)c2ccc(OC)cc2)c2ccc(OC)cc2)cc1 |
CHEMICAL IDENTIFICATION
|
| HS Code | 2909309090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Tetra-anisylethylene |
| Tetra-p-anisylethylene |