Phenyl tribromomethyl sulfone structure
|
Common Name | Phenyl tribromomethyl sulfone | ||
|---|---|---|---|---|
| CAS Number | 17025-47-7 | Molecular Weight | 392.890 | |
| Density | 2.3±0.1 g/cm3 | Boiling Point | 373.8±42.0 °C at 760 mmHg | |
| Molecular Formula | C7H5Br3O2S | Melting Point | 145-147 °C(lit.) | |
| MSDS | N/A | Flash Point | 179.9±27.9 °C | |
| Name | Phenyl Tribromomethyl Sulfone |
|---|---|
| Synonym | More Synonyms |
| Density | 2.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 373.8±42.0 °C at 760 mmHg |
| Melting Point | 145-147 °C(lit.) |
| Molecular Formula | C7H5Br3O2S |
| Molecular Weight | 392.890 |
| Flash Point | 179.9±27.9 °C |
| Exact Mass | 389.756012 |
| PSA | 42.52000 |
| LogP | 4.51 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.664 |
| InChIKey | DWWMSEANWMWMCB-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccccc1)C(Br)(Br)Br |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| WGK Germany | 3 |
| HS Code | 2904909090 |
|
~98%
Phenyl tribromo... CAS#:17025-47-7 |
| Literature: Fields, D. L.; Shechter, H. Journal of Organic Chemistry, 1986 , vol. 51, # 17 p. 3369 - 3371 |
|
~%
Phenyl tribromo... CAS#:17025-47-7 |
| Literature: Journal fuer Praktische Chemie (Leipzig), , vol. <2> 71, p. 232 |
|
~%
Phenyl tribromo... CAS#:17025-47-7 |
| Literature: Journal fuer Praktische Chemie (Leipzig), , vol. <2> 71, p. 232 |
|
~%
Phenyl tribromo... CAS#:17025-47-7 |
| Literature: Gazzetta Chimica Italiana, , vol. 103, p. 809 - 812 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Tribromomethyl phenyl sulfone |
| tribromomethylsulfonylbenzene |
| Benzene, [(tribromomethyl)sulfonyl]- |
| ((Tribromomethyl)sulfonyl)benzene |
| ((Tribromomethyl)sulphonyl)benzene |
| MFCD00060068 |
| [(Tribromomethyl)sulfonyl]benzene |
| EINECS 241-096-6 |
| Benzene, ((tribromomethyl)sulfonyl)- |
| Phenyl tribromomethyl sulfone |