2-[(4-Aminophenyl)sulfonyl]ethyl hydrogen sulfate structure
|
Common Name | 2-[(4-Aminophenyl)sulfonyl]ethyl hydrogen sulfate | ||
|---|---|---|---|---|
| CAS Number | 2494-89-5 | Molecular Weight | 281.30600 | |
| Density | 1.608g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H11NO6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-aminophenyl)sulfonylethyl hydrogen sulfate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.608g/cm3 |
|---|---|
| Molecular Formula | C8H11NO6S2 |
| Molecular Weight | 281.30600 |
| Exact Mass | 281.00300 |
| PSA | 140.52000 |
| LogP | 2.60470 |
| Index of Refraction | 1.608 |
| InChIKey | IALORYHODRVWKZ-UHFFFAOYSA-N |
| SMILES | Nc1ccc(S(=O)(=O)CCOS(=O)(=O)O)cc1 |
| Hazard Codes | C |
|---|---|
| HS Code | 2922199090 |
|
~94%
2-[(4-Aminophen... CAS#:2494-89-5 |
| Literature: Sumitomo Chemical Company, Limited Patent: US4482501 A1, 1984 ; |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Ethanol,2-sulfanilyl-,hydrogen sulfate (ester) |
| Ethanol,2-[(4-aminophenyl)sulfonyl]-,hydrogen sulfate (ester) |
| 4-(-sulfatoethylsulfonyl)aniline |
| {2-[(4-aminobenzene)sulfonyl]ethoxy}sulfonic acid |
| 2-((p-Aminophenyl)sulphonyl)ethyl hydrogensulphate |
| 4-aminophenyl 2"-sulphatoethyl sulphone |
| EINECS 219-669-7 |
| 2-[(4-aminophenyl)sulfonyl]ethyl hydrogen sulfate |
| 4-((2-(sulfooxy)-ethyl)-sulfonyl)-phenylamine |
| 4-((2-Sulfatoethyl)sulfonyl)aniline |