1-Piperidinecarboxylic acid, 4-phenyl-, phenylmethyl ester
1-Piperidinecarboxylic acid, 4-phenyl-, phenylmethyl ester structure
|
Common Name | 1-Piperidinecarboxylic acid, 4-phenyl-, phenylmethyl ester | ||
|---|---|---|---|---|
| CAS Number | 733810-73-6 | Molecular Weight | 295.37600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | phenylmethyl 4-phenylhexahydropyridine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H21NO2 |
|---|---|
| Molecular Weight | 295.37600 |
| Exact Mass | 295.15700 |
| PSA | 29.54000 |
| LogP | 4.14070 |
| InChIKey | ZKUSZCIYPJCXIR-UHFFFAOYSA-N |
| SMILES | O=C(OCc1ccccc1)N1CCC(c2ccccc2)CC1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:56296-78-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-phenylpiperidine-1-carboxylic acid benzyl ester |
| benzyl 4-phenylpiperidine-1-carboxylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of phenylmethyl 4-phenylhexahydropyridine-1-carboxylate? |
| A: Related downstream products(CAS) of phenylmethyl 4-phenylhexahydropyridine-1-carboxylate: 56296-78-7. |
| Q: What is the polar surface area (PSA) of phenylmethyl 4-phenylhexahydropyridine-1-carboxylate? |
| A: Polar surface area (PSA) of phenylmethyl 4-phenylhexahydropyridine-1-carboxylate is 29.54000. |
| Q: What is the molecular formula of phenylmethyl 4-phenylhexahydropyridine-1-carboxylate? |
| A: Molecular formula of phenylmethyl 4-phenylhexahydropyridine-1-carboxylate is C19H21NO2. |
| Q: What English synonyms does phenylmethyl 4-phenylhexahydropyridine-1-carboxylate have? |
| A: English synonyms of phenylmethyl 4-phenylhexahydropyridine-1-carboxylate: 4-phenylpiperidine-1-carboxylic acid benzyl ester, benzyl 4-phenylpiperidine-1-carboxylate. |
| Q: What is the molecular weight of phenylmethyl 4-phenylhexahydropyridine-1-carboxylate? |
| A: Molecular weight of phenylmethyl 4-phenylhexahydropyridine-1-carboxylate is 295.37600. |
| Q: What is the SMILES notation of phenylmethyl 4-phenylhexahydropyridine-1-carboxylate? |
| A: SMILES notation of phenylmethyl 4-phenylhexahydropyridine-1-carboxylate is O=C(OCc1ccccc1)N1CCC(c2ccccc2)CC1. |
| Q: What is the CAS number of phenylmethyl 4-phenylhexahydropyridine-1-carboxylate? |
| A: CAS number of phenylmethyl 4-phenylhexahydropyridine-1-carboxylate is 733810-73-6. |
| Q: What is the English name of phenylmethyl 4-phenylhexahydropyridine-1-carboxylate? |
| A: The English name of phenylmethyl 4-phenylhexahydropyridine-1-carboxylate is phenylmethyl 4-phenylhexahydropyridine-1-carboxylate. |
| Q: What is the LogP of phenylmethyl 4-phenylhexahydropyridine-1-carboxylate? |
| A: LogP of phenylmethyl 4-phenylhexahydropyridine-1-carboxylate is 4.14070. |
| Q: What is the InChIKey of phenylmethyl 4-phenylhexahydropyridine-1-carboxylate? |
| A: InChIKey of phenylmethyl 4-phenylhexahydropyridine-1-carboxylate is ZKUSZCIYPJCXIR-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |