ethyl 1-Methylindole-6-carboxylate
ethyl 1-Methylindole-6-carboxylate structure
|
Common Name | ethyl 1-Methylindole-6-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 202745-74-2 | Molecular Weight | 203.23700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Ethyl 1-methyl-1H-indole-6-carboxylate (Chinese name: 1-甲基-1H-吲哚-6-羧酸乙酯，CAS number: 202745-74-2)， molecular formula C12H13NO2，molecular weight 203.23700. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 1-methyl-1H-indole-6-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H13NO2 |
|---|---|
| Molecular Weight | 203.23700 |
| Exact Mass | 203.09500 |
| PSA | 31.23000 |
| LogP | 2.35500 |
| InChIKey | DONAUJDYIXJJJF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc2ccn(C)c2c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
ethyl 1-Methyli... CAS#:202745-74-2 |
| Literature: Rigby, James H.; Burke, Patrick J. Heterocycles, 2006 , vol. 67, # 2 p. 643 - 653 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 2 | |
CAS#:898289-03-7
CAS#:202745-73-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5-carbaldehyde-N-methylindole |
| 1-Methyl-1H-indole-5-carboxaldehyde |
| N-methyl-1H-indole-5-carbaldehyde |
| 1-methyl-1H-indole-6-carboxylic acid ethyl ester |
| N-methyl-5-indolecarboxaldehyde |
| ethyl 1-methylindole-6-carboxylate |
| 1-methyl-1H-indole-5-carbaldehyde |
| N-methylindol-5-carbaldehyde |
| 1-methylindole-5-carboxaldehyde |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Ethyl 1-methyl-1H-indole-6-carboxylate? |
| A: Molecular weight of Ethyl 1-methyl-1H-indole-6-carboxylate is 203.23700. |
| Q: What are the downstream products of Ethyl 1-methyl-1H-indole-6-carboxylate? |
| A: Related downstream products(CAS) of Ethyl 1-methyl-1H-indole-6-carboxylate: 898289-03-7;202745-73-1. |
| Q: What is the SMILES notation of Ethyl 1-methyl-1H-indole-6-carboxylate? |
| A: SMILES notation of Ethyl 1-methyl-1H-indole-6-carboxylate is CCOC(=O)c1ccc2ccn(C)c2c1. |
| Q: What is the InChIKey of Ethyl 1-methyl-1H-indole-6-carboxylate? |
| A: InChIKey of Ethyl 1-methyl-1H-indole-6-carboxylate is DONAUJDYIXJJJF-UHFFFAOYSA-N. |
| Q: What are the upstream materials of Ethyl 1-methyl-1H-indole-6-carboxylate? |
| A: Related upstream materials(CAS) of Ethyl 1-methyl-1H-indole-6-carboxylate: 50820-64-9;74-88-4. |
| Q: What is the LogP of Ethyl 1-methyl-1H-indole-6-carboxylate? |
| A: LogP of Ethyl 1-methyl-1H-indole-6-carboxylate is 2.35500. |
| Q: What is the English name of Ethyl 1-methyl-1H-indole-6-carboxylate? |
| A: The English name of Ethyl 1-methyl-1H-indole-6-carboxylate is Ethyl 1-methyl-1H-indole-6-carboxylate. |
| Q: What is the CAS number of Ethyl 1-methyl-1H-indole-6-carboxylate? |
| A: CAS number of Ethyl 1-methyl-1H-indole-6-carboxylate is 202745-74-2. |
| Q: What is the polar surface area (PSA) of Ethyl 1-methyl-1H-indole-6-carboxylate? |
| A: Polar surface area (PSA) of Ethyl 1-methyl-1H-indole-6-carboxylate is 31.23000. |
| Q: What is the molecular formula of Ethyl 1-methyl-1H-indole-6-carboxylate? |
| A: Molecular formula of Ethyl 1-methyl-1H-indole-6-carboxylate is C12H13NO2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |