N-Boc-PEG8-alcohol structure
|
Common Name | N-Boc-PEG8-alcohol | ||
|---|---|---|---|---|
| CAS Number | 1345337-22-5 | Molecular Weight | 297.30376 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H43NO10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N-Boc-PEG8-alcoholN-Boc-PEG8-alcohol is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Z-8-aMino-3,6-dioxaoctanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | N-Boc-PEG8-alcohol is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C21H43NO10 |
|---|---|
| Molecular Weight | 297.30376 |
| InChIKey | WHRVSFPIFWXKQZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCOCCOCCO |
| CBZ-8-AMINO-3,6-DIOXAOCTANOIC ACID |