1,2-bis(tosyloxy)ethane structure
|
Common Name | 1,2-bis(tosyloxy)ethane | ||
|---|---|---|---|---|
| CAS Number | 6315-52-2 | Molecular Weight | 370.44100 | |
| Density | 1.326g/cm3 | Boiling Point | 544.3ºC at 760 mmHg | |
| Molecular Formula | C16H18O6S2 | Melting Point | 124-127 °C(lit.) | |
| MSDS | USA | Flash Point | 283ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Ethane-1,2-diyl bis(4-methylbenzenesulfonate) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.326g/cm3 |
|---|---|
| Boiling Point | 544.3ºC at 760 mmHg |
| Melting Point | 124-127 °C(lit.) |
| Molecular Formula | C16H18O6S2 |
| Molecular Weight | 370.44100 |
| Flash Point | 283ºC |
| Exact Mass | 370.05400 |
| PSA | 103.50000 |
| LogP | 4.57580 |
| Index of Refraction | 1.566 |
| InChIKey | LZIPBJBQQPZLOR-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCOS(=O)(=O)c2ccc(C)cc2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2942000000 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2942000000 |
|---|
|
Characterization of (18)F-dipicolylamine (DPA) derivatives in cells infected with influenza virus.
Nucl. Med. Biol. 42(3) , 283-91, (2015) Bis(Zn-dipicolylamine (Zn-DPA)) coordination complexes represent a new class of synthetic small molecules that can target anionic phosphatidylserine (PS) in the apoptotic cells with high affinity and ... |
|
|
Investigation of macrocyclisation routes to 1,4,7-triazacyclononanes: efficient syntheses from 1,2-ditosylamides.
Org. Biomol. Chem. 6(2) , 374-84, (2008) Two routes to the synthesis of a cyclohexyl-fused 1,4,7-triazacyclononane involving macrocyclisations of tosamides have been investigated. In the first approach, using a classic Richman-Atkins-type cy... |
|
|
Selective bridging of p-tert-butylcalix [6] arene with polyethylene glycol ditosylates. Li J, et al.
Tetrahedron 55(34) , 10365-74, (1999)
|
| MFCD00008549 |
| 2-(4-methylphenyl)sulfonyloxyethyl 4-methylbenzenesulfonate |