phytolaccagenic acid structure
|
Common Name | phytolaccagenic acid | ||
|---|---|---|---|---|
| CAS Number | 54928-05-1 | Molecular Weight | 516.709 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 623.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C31H48O6 | Melting Point | 143-146 °C | |
| MSDS | N/A | Flash Point | 194.1±25.0 °C | |
Use of phytolaccagenic acidPhytolaccagenic acid is the main composition of quinoa saponin. Phytolaccagenic acid is an active compound. Phytolaccagenic acid can be used for the research of various biochemical[1]. |
| Name | (2R,4aR,6aR,6aS,6bR,9R,10S,12aR,14bR)-10-hydroxy-9-(hydroxymethyl)-2-methoxycarbonyl-2,6a,6b,9,12a-pentamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Phytolaccagenic acid is the main composition of quinoa saponin. Phytolaccagenic acid is an active compound. Phytolaccagenic acid can be used for the research of various biochemical[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Jeong Gyu Lim, et al. Analysis of saponin composition and comparison of the |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 623.4±55.0 °C at 760 mmHg |
| Melting Point | 143-146 °C |
| Molecular Formula | C31H48O6 |
| Molecular Weight | 516.709 |
| Flash Point | 194.1±25.0 °C |
| Exact Mass | 516.345093 |
| PSA | 104.06000 |
| LogP | 6.14 |
| Vapour Pressure | 0.0±4.1 mmHg at 25°C |
| Index of Refraction | 1.571 |
| InChIKey | YAGYBNOEVSEGSL-HGDAMUQJSA-N |
| SMILES | COC(=O)C1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(CO)C5CCC43C)C2C1 |
| Phytolaccagenic acid |
| (3β)-3,23-Dihydroxy-30-methoxy-30-oxoolean-12-en-28-oic acid |