| Name | N'-(7-chloroquinolin-4-yl)-N-cyclohexylethane-1,2-diamine |
|---|---|
| Synonyms |
N-(7-Chlor-[4]chinolyl)-N'-cyclohexyl-aethylendiamin
N-(7-chloro-[4]quinolyl)-N'-cyclohexyl-ethylenediamine N-(7-chloroquinolin-4-yl)-N'-cyclohexylethane-1,2-diamine |
| Density | 1.41g/cm3 |
|---|---|
| Molecular Formula | C17H22ClN3 |
| Molecular Weight | 303.83000 |
| Exact Mass | 303.15000 |
| PSA | 36.95000 |
| LogP | 4.68630 |
| Index of Refraction | 1.682 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |