| Name | chloro-tris(4-chlorophenyl)stannane |
|---|---|
| Synonyms |
chloro[tris(4-chlorophenyl)]stannane
tris(p-chlorophenyl)tin chloride tri(p-chlorophenyl)tin chloride Tris-(p-chlorphenyl)-zinnchlorid tris(para-chlorophenyl)tin chloride Stannane,chlorotris(4-chlorophenyl) tri(4-chlorophenyl)-tin chloride |
| Boiling Point | 469.9ºC at 760mmHg |
|---|---|
| Molecular Formula | C18H12Cl4Sn |
| Molecular Weight | 488.80100 |
| Flash Point | 238ºC |
| Exact Mass | 487.87200 |
| LogP | 4.85250 |
| Vapour Pressure | 1.5E-08mmHg at 25°C |
| HS Code | 2931900090 |
|---|
|
~74%
1235-30-9 |
| Literature: Gmelin Handbook: Sn: Org.Verb.1, 1.1.1.16.6, page 169 - 176 |
|
~%
1235-30-9 |
| Literature: Gmelin Handbook: Sn: Org.Verb.1, 1.1.1.16.6, page 169 - 176 |
|
~%
1235-30-9 |
| Literature: Gmelin Handbook: Sn: Org.Verb.1, 1.1.1.16.6, page 169 - 176 |
|
~%
1235-30-9 |
| Literature: Gmelin Handbook: Sn: Org.Verb.1, 1.1.1.16.6, page 169 - 176 |
|
~%
1235-30-9 |
| Literature: Gmelin Handbook: Sn: Org.Verb.1, 1.1.1.16.6, page 169 - 176 |
| Precursor 5 | |
|---|---|
| DownStream 1 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |