| Name |
6-(4-Fluorophenyl)-[1,2,4]triazolo[3,2-b][1,3]thiazol-2-amine
|
| Molecular Formula |
C10H7FN4S
|
| Molecular Weight |
234.26
|
| Smiles |
Nc1nc2scc(-c3ccc(F)cc3)n2n1
|
Nc1nc2scc(-c3ccc(F)cc3)n2n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.