| Name |
dimethyl 2-(2-(methylsulfonyl)benzamido)-4,5-dihydrothieno[2,3-c]pyridine-3,6(7H)-dicarboxylate
|
| Molecular Formula |
C19H20N2O7S2
|
| Molecular Weight |
452.5
|
| Smiles |
COC(=O)c1c(NC(=O)c2ccccc2S(C)(=O)=O)sc2c1CCN(C(=O)OC)C2
|
COC(=O)c1c(NC(=O)c2ccccc2S(C)(=O)=O)sc2c1CCN(C(=O)OC)C2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.