| Name |
3-{[4,6-Bis(morpholin-4-yl)-1,3,5-triazin-2-yl]amino}-1-(3,4-dimethylphenyl)thiourea
|
| Molecular Formula |
C20H28N8O2S
|
| Molecular Weight |
444.6
|
| Smiles |
Cc1ccc(NC(=S)NNc2nc(N3CCOCC3)nc(N3CCOCC3)n2)cc1C
|
Cc1ccc(NC(=S)NNc2nc(N3CCOCC3)nc(N3CCOCC3)n2)cc1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.