| Name |
3-(4-Amino-3-((2-((3,4-dimethoxyphenyl)amino)-2-oxoethyl)thio)-5-oxo-4,5-dihydro-1,2,4-triazin-6-yl)propanoic acid
|
| Molecular Formula |
C16H19N5O6S
|
| Molecular Weight |
409.4
|
| Smiles |
COc1ccc(NC(=O)CSc2nnc(CCC(=O)O)c(=O)n2N)cc1OC
|
COc1ccc(NC(=O)CSc2nnc(CCC(=O)O)c(=O)n2N)cc1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.