| Name |
ethyl 2-[({[5,7-bis(ethylamino)[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl}acetyl)amino]-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]thiophene-3-carboxylate
|
| Molecular Formula |
C20H28N8O3S2
|
| Molecular Weight |
492.6
|
| Smiles |
CCNc1nc(NCC)n2c(SCC(=O)NC3=C(C(=O)OCC)C4CCCC4S3)nnc2n1
|
CCNc1nc(NCC)n2c(SCC(=O)NC3=C(C(=O)OCC)C4CCCC4S3)nnc2n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.