| Name |
5-Chloro-7-nitro-2,3-dihydro-1-benzofuran
|
| Molecular Formula |
C8H6ClNO3
|
| Molecular Weight |
199.59
|
| Smiles |
O=[N+]([O-])c1cc(Cl)cc2c1OCC2
|
O=[N+]([O-])c1cc(Cl)cc2c1OCC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.