| Name |
6-isopropyl-5-mercapto-1,3-dimethylpyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione
|
| Molecular Formula |
C12H15N3O2S
|
| Molecular Weight |
265.33
|
| Smiles |
CC(C)c1c[nH]c2c(c1=S)c(=O)n(C)c(=O)n2C
|
CC(C)c1c[nH]c2c(c1=S)c(=O)n(C)c(=O)n2C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.