| Name |
N-(3-chloro-4-fluorophenyl)-2-(5-(4-chlorophenyl)-4,6-dioxo-4,5,6,6a-tetrahydropyrrolo[3,4-d][1,2,3]triazol-1(3aH)-yl)acetamide
|
| Molecular Formula |
C18H12Cl2FN5O3
|
| Molecular Weight |
436.2
|
| Smiles |
O=C(CN1N=NC2C(=O)N(c3ccc(Cl)cc3)C(=O)C21)Nc1ccc(F)c(Cl)c1
|
O=C(CN1N=NC2C(=O)N(c3ccc(Cl)cc3)C(=O)C21)Nc1ccc(F)c(Cl)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.