| Name |
1-(2-Carboxyphenyl)-2,4,6-triphenylpyridinium perchlorate
|
| Molecular Formula |
C30H22ClNO6
|
| Molecular Weight |
527.9
|
| Smiles |
O=C(O)c1ccccc1-[n+]1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccc1.[O-][Cl+3]([O-])([O-])[O-]
|
O=C(O)c1ccccc1-[n+]1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccc1.[O-][Cl+3]([O-])([O-])[O-]
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.