| Name |
1-[4-(4-{3-[(4-Bromophenyl)sulfonyl][1,2,3]triazolo[1,5-a]quinazolin-5-yl}piperazin-1-yl)phenyl]ethanone
|
| Molecular Formula |
C27H23BrN6O3S
|
| Molecular Weight |
591.5
|
| Smiles |
CC(=O)c1ccc(N2CCN(c3nc4c(S(=O)(=O)c5ccc(Br)cc5)nnn4c4ccccc34)CC2)cc1
|
CC(=O)c1ccc(N2CCN(c3nc4c(S(=O)(=O)c5ccc(Br)cc5)nnn4c4ccccc34)CC2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.