| Name |
N-(2H-1,3-benzodioxol-5-yl)-2-{6,7-dimethoxy-2-oxo-3-[(phenylamino)methyl]-1,2-dihydroquinolin-1-yl}acetamide
|
| Molecular Formula |
C27H25N3O6
|
| Molecular Weight |
487.5
|
| Smiles |
COc1cc2cc(CNc3ccccc3)c(=O)n(CC(=O)Nc3ccc4c(c3)OCO4)c2cc1OC
|
COc1cc2cc(CNc3ccccc3)c(=O)n(CC(=O)Nc3ccc4c(c3)OCO4)c2cc1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.