| Name |
2-{2-[(3aS,6aS)-5-(2-methoxyphenyl)-4,6-dioxo-1,3a,4,5,6,6a-hexahydropyrrolo[3,4-c]pyrazol-3-yl]-2-oxoethyl}-1H-isoindole-1,3(2H)-dione
|
| Molecular Formula |
C22H16N4O6
|
| Molecular Weight |
432.4
|
| Smiles |
COc1ccccc1N1C(=O)C2NN=C(C(=O)CN3C(=O)c4ccccc4C3=O)C2C1=O
|
COc1ccccc1N1C(=O)C2NN=C(C(=O)CN3C(=O)c4ccccc4C3=O)C2C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.