| Name |
11-[(4-Methoxyphenyl)methyl]-7-thia-9,11-diazatricyclo[6.4.0.0^{2,6}]dodeca-1(8),2(6),9-trien-12-one
|
| Molecular Formula |
C17H16N2O2S
|
| Molecular Weight |
312.4
|
| Smiles |
COc1ccc(Cn2cnc3sc4c(c3c2=O)CCC4)cc1
|
COc1ccc(Cn2cnc3sc4c(c3c2=O)CCC4)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.