| Name |
Ethyl 3-(5-methyl-7-oxo-2-phenyl-4,7-dihydro[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoate
|
| Molecular Formula |
C17H18N4O3
|
| Molecular Weight |
326.35
|
| Smiles |
CCOC(=O)CCc1c(C)nc2nc(-c3ccccc3)[nH]n2c1=O
|
CCOC(=O)CCc1c(C)nc2nc(-c3ccccc3)[nH]n2c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.