| Name |
N-(2-chlorophenyl)-4,7-dimethyl-8-phenylpyrazolo[5,1-c][1,2,4]triazine-3-carboxamide
|
| Molecular Formula |
C20H16ClN5O
|
| Molecular Weight |
377.8
|
| Smiles |
Cc1nn2c(C)c(C(=O)Nc3ccccc3Cl)nnc2c1-c1ccccc1
|
Cc1nn2c(C)c(C(=O)Nc3ccccc3Cl)nnc2c1-c1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.