| Name |
6-phenyl-2-(pyridin-3-ylmethyl)-2,3,4,6-tetrahydro-1H-[1,3,5]triazino[1',2':3,4][1,3,5]triazino[1,2-a]benzimidazole
|
| Molecular Formula |
C23H21N7
|
| Molecular Weight |
395.5
|
| Smiles |
c1ccc(C2NC3=NCN(Cc4cccnc4)CN3c3nc4ccccc4n32)cc1
|
c1ccc(C2NC3=NCN(Cc4cccnc4)CN3c3nc4ccccc4n32)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.