| Name |
2-methoxy-4-{2-[1-(2-morpholinoethyl)[1,3,5]triazino[1,2-a][1,3]benzimidazol-3(2H,4H)-yl]ethyl}phenyl methyl ether
|
| Molecular Formula |
C25H33N5O3
|
| Molecular Weight |
451.6
|
| Smiles |
COc1ccc(CCN2CN(CCN3CCOCC3)c3nc4ccccc4n3C2)cc1OC
|
COc1ccc(CCN2CN(CCN3CCOCC3)c3nc4ccccc4n3C2)cc1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.