| Name |
4-(3-(6-(pyridin-2-yl)-3,4-dihydro-1H-benzo[4,5]imidazo[1,2-a][1,3,5]triazino[1,2-c][1,3,5]triazin-2(6H)-yl)propyl)morpholine
|
| Molecular Formula |
C23H28N8O
|
| Molecular Weight |
432.5
|
| Smiles |
c1ccc(C2NC3=NCN(CCCN4CCOCC4)CN3c3nc4ccccc4n32)nc1
|
c1ccc(C2NC3=NCN(CCCN4CCOCC4)CN3c3nc4ccccc4n32)nc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.