| Name |
3-(3-chlorophenyl)-2-(methoxymethyl)-8,8-dimethyl-8,9-dihydropyrazolo[1,5-a]quinazolin-6(7H)-one
|
| Molecular Formula |
C20H20ClN3O2
|
| Molecular Weight |
369.8
|
| Smiles |
COCc1nn2c3c(cnc2c1-c1cccc(Cl)c1)C(=O)CC(C)(C)C3
|
COCc1nn2c3c(cnc2c1-c1cccc(Cl)c1)C(=O)CC(C)(C)C3
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.