| Name |
N-(4-chlorophenyl)-2-{[4-({[4-(trifluoromethyl)phenyl]carbamoyl}methyl)-1,3-thiazol-2-yl]sulfanyl}acetamide
|
| Molecular Formula |
C20H15ClF3N3O2S2
|
| Molecular Weight |
485.9
|
| Smiles |
O=C(CSc1nc(CC(=O)Nc2ccc(C(F)(F)F)cc2)cs1)Nc1ccc(Cl)cc1
|
O=C(CSc1nc(CC(=O)Nc2ccc(C(F)(F)F)cc2)cs1)Nc1ccc(Cl)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.