| Name |
N-formyl-9h-pyrido[3,4-b]indole-3-carboxamide
|
| Molecular Formula |
C13H9N3O2
|
| Molecular Weight |
239.23
|
| Smiles |
O=CNC(=O)c1cc2c(cn1)[nH]c1ccccc12
|
O=CNC(=O)c1cc2c(cn1)[nH]c1ccccc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.