| Name |
2-Propenoic acid, 2-methyl-, 2,15-dihydroxy-4,7,10,13-tetraoxahexadecane-1,16-diyl ester
|
| Molecular Formula |
C20H34O10
|
| Molecular Weight |
434.5
|
| Smiles |
C=C(C)C(=O)OCC(O)COCCOCCOCCOCC(O)COC(=O)C(=C)C
|
C=C(C)C(=O)OCC(O)COCCOCCOCCOCC(O)COC(=O)C(=C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.