| Name |
[5-Chloro-2-(2,2-dimethylpropanoylamino)-3,6-dimethoxyphenyl]boronic acid
|
| Molecular Formula |
C13H19BClNO5
|
| Molecular Weight |
315.56
|
| Smiles |
COc1cc(Cl)c(OC)c(B(O)O)c1NC(=O)C(C)(C)C
|
COc1cc(Cl)c(OC)c(B(O)O)c1NC(=O)C(C)(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.