| Name |
2-[4-(2-Ethoxyethoxy)-1-naphthalenyl]-4,6-bis(trichloromethyl)-1,3,5-triazine
|
| Molecular Formula |
C19H15Cl6N3O2
|
| Molecular Weight |
530.0
|
| Smiles |
CCOCCOc1ccc(-c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)c2ccccc12
|
CCOCCOc1ccc(-c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)c2ccccc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.