| Name |
3-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(1,1-dioxidotetrahydrothiophen-3-yl)propanamide
|
| Molecular Formula |
C17H21N3O6S
|
| Molecular Weight |
395.4
|
| Smiles |
COc1ccc(-c2noc(CCC(=O)NC3CCS(=O)(=O)C3)n2)cc1OC
|
COc1ccc(-c2noc(CCC(=O)NC3CCS(=O)(=O)C3)n2)cc1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.