| Name |
1H-Pyrazole-1-ethanamine, alpha-(2,3-dihydro-1,4-benzodioxin-6-yl)-3,5-dimethyl-
|
| Molecular Formula |
C15H19N3O2
|
| Molecular Weight |
273.33
|
| Smiles |
Cc1cc(C)n(CC(N)c2ccc3c(c2)OCCO3)n1
|
Cc1cc(C)n(CC(N)c2ccc3c(c2)OCCO3)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.