| Name |
Methyl 4-{[3-(4-fluorophenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]amino}benzoate
|
| Molecular Formula |
C17H13FN2O4S
|
| Molecular Weight |
360.4
|
| Smiles |
COC(=O)c1ccc(NC2SC(=O)N(c3ccc(F)cc3)C2=O)cc1
|
COC(=O)c1ccc(NC2SC(=O)N(c3ccc(F)cc3)C2=O)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.