| Name |
5,6,7,8-Tetrahydro-4-methoxy-5,6-dimethyl-1,3-dioxolo[4,5-g]isoquinoline
|
| Molecular Formula |
C13H17NO3
|
| Molecular Weight |
235.28
|
| Smiles |
COc1c2c(cc3c1C(C)N(C)CC3)OCO2
|
COc1c2c(cc3c1C(C)N(C)CC3)OCO2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.