| Name |
[tert-butyl(diphenyl)silyl] (14R)-14-hydroxy-9-methoxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene-4-carboxylate
|
| Molecular Formula |
C33H37NO5Si
|
| Molecular Weight |
555.7
|
| Smiles |
COc1ccc2c3c1OC1CC(O)C=CC31CCN(C(=O)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C2
|
COc1ccc2c3c1OC1CC(O)C=CC31CCN(C(=O)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.