| Name |
4-Chloro-3-(1,1,3-trioxo-1$l^{6},2-thiazolidin-2-yl)benzoyl chloride
|
| Molecular Formula |
C10H7Cl2NO4S
|
| Molecular Weight |
308.14
|
| Smiles |
O=C(Cl)c1ccc(Cl)c(N2C(=O)CCS2(=O)=O)c1
|
O=C(Cl)c1ccc(Cl)c(N2C(=O)CCS2(=O)=O)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.