| Name |
3-(4,4-Dimethyl-1,1,3-trioxo-1$l^{6},2-thiazolidin-2-yl)benzoyl chloride
|
| Molecular Formula |
C12H12ClNO4S
|
| Molecular Weight |
301.75
|
| Smiles |
CC1(C)CS(=O)(=O)N(c2cccc(C(=O)Cl)c2)C1=O
|
CC1(C)CS(=O)(=O)N(c2cccc(C(=O)Cl)c2)C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.