| Name |
Ethyl 2-((5,6-dihydrothiazolo[2,3-c][1,2,4]triazol-3-yl)amino)-2-oxoacetate
|
| Molecular Formula |
C8H10N4O3S
|
| Molecular Weight |
242.26
|
| Smiles |
CCOC(=O)C(=O)Nc1nnc2n1CCS2
|
CCOC(=O)C(=O)Nc1nnc2n1CCS2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.