| Name |
N-(5,6-dihydrothiazolo[2,3-c][1,2,4]triazol-3-yl)-2,4-difluorobenzamide
|
| Molecular Formula |
C11H8F2N4OS
|
| Molecular Weight |
282.27
|
| Smiles |
O=C(Nc1nnc2n1CCS2)c1ccc(F)cc1F
|
O=C(Nc1nnc2n1CCS2)c1ccc(F)cc1F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.