| Name |
N-(2-(2-(4-methoxyphenyl)thiazolo[3,2-b][1,2,4]triazol-6-yl)ethyl)-2,3-dihydrobenzo[b][1,4]dioxine-6-sulfonamide
|
| Molecular Formula |
C21H20N4O5S2
|
| Molecular Weight |
472.5
|
| Smiles |
COc1ccc(-c2nc3scc(CCNS(=O)(=O)c4ccc5c(c4)OCCO5)n3n2)cc1
|
COc1ccc(-c2nc3scc(CCNS(=O)(=O)c4ccc5c(c4)OCCO5)n3n2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.