| Name |
(2,6-Ditert-butyl-4-methylcyclohexyl) 2-[2-acetyl-5-(4-tert-butylphenyl)-1,2,4-triazol-3-yl]acetate
|
| Molecular Formula |
C31H47N3O3
|
| Molecular Weight |
509.7
|
| Smiles |
CC(=O)n1nc(-c2ccc(C(C)(C)C)cc2)nc1CC(=O)OC1C(C(C)(C)C)CC(C)CC1C(C)(C)C
|
CC(=O)n1nc(-c2ccc(C(C)(C)C)cc2)nc1CC(=O)OC1C(C(C)(C)C)CC(C)CC1C(C)(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.