| Name |
[(3aR,5S,6S,6aR)-5-formyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate
|
| Molecular Formula |
C10H14O6
|
| Molecular Weight |
230.21
|
| Smiles |
CC(=O)OC1C(C=O)OC2OC(C)(C)OC21
|
CC(=O)OC1C(C=O)OC2OC(C)(C)OC21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.