| Name |
N-(3,4-dimethylphenyl)-2-{[5-(4-ethoxyphenyl)-6-oxo-8-oxa-3,5-diazatricyclo[7.4.0.0^{2,7}]trideca-1(9),2(7),3,10,12-pentaen-4-yl]sulfanyl}acetamide
|
| Molecular Formula |
C28H25N3O4S
|
| Molecular Weight |
499.6
|
| Smiles |
CCOc1ccc(-n2c(SCC(=O)Nc3ccc(C)c(C)c3)nc3c(oc4ccccc43)c2=O)cc1
|
CCOc1ccc(-n2c(SCC(=O)Nc3ccc(C)c(C)c3)nc3c(oc4ccccc43)c2=O)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.